2,3-dimethoxy-5-nitrobenzoic acid

C9H9NO6 — CID 12007954

IUPAC2,3-dimethoxy-5-nitrobenzoic acid
SMILESCOc1cc([N+](=O)[O-])cc(C(=O)O)c1OC
InChIInChI=1S/C9H9NO6/c1-15-7-4-5(10(13)14)3-6(9(11)12)8(7)16-2/h3-4H,1-2H3,(H,11,12)
InChIKeyZQAXATYFPVCKFM-UHFFFAOYSA-N
MW227.17 g/mol
LogP1.31
Rot. Bonds4

About 2,3-dimethoxy-5-nitrobenzoic acid

2,3-dimethoxy-5-nitrobenzoic acid (PubChem CID 12007954) has the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. Its IUPAC name is 2,3-dimethoxy-5-nitrobenzoic acid.

Molecular Properties

Compound Name2,3-dimethoxy-5-nitrobenzoic acid
PubChem CID12007954
Molecular FormulaC9H9NO6
Molecular Weight227.17 g/mol
Exact Mass227.04
IUPAC Name2,3-dimethoxy-5-nitrobenzoic acid
SMILESCOc1cc([N+](=O)[O-])cc(C(=O)O)c1OC
InChIInChI=1S/C9H9NO6/c1-15-7-4-5(10(13)14)3-6(9(11)12)8(7)16-2/h3-4H,1-2H3,(H,11,12)
InChIKeyZQAXATYFPVCKFM-UHFFFAOYSA-N
XLogP1.31
TPSA98.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.17
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2,3-dimethoxy-5-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethoxy-5-nitrobenzoic acid?
The IUPAC name of 2,3-dimethoxy-5-nitrobenzoic acid (CID 12007954) is 2,3-dimethoxy-5-nitrobenzoic acid.
What is the SMILES notation for 2,3-dimethoxy-5-nitrobenzoic acid?
The canonical SMILES for 2,3-dimethoxy-5-nitrobenzoic acid is COc1cc([N+](=O)[O-])cc(C(=O)O)c1OC.
What is the InChIKey of 2,3-dimethoxy-5-nitrobenzoic acid?
The InChIKey is ZQAXATYFPVCKFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO6/c1-15-7-4-5(10(13)14)3-6(9(11)12)8(7)16-2/h3-4H,1-2H3,(H,11,12).
What are the key properties of 2,3-dimethoxy-5-nitrobenzoic acid?
2,3-dimethoxy-5-nitrobenzoic acid has a molecular weight of 227.17 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-5-nitrobenzoic acid is sourced from PubChem (CID 12007954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).