About phosphanyl 2,3,4,5-tetraphenylbenzoate
phosphanyl 2,3,4,5-tetraphenylbenzoate (PubChem CID 141485205) has the molecular formula C31H23O2P
and a molecular weight of 458.50 g/mol. Its IUPAC name is phosphanyl 2,3,4,5-tetraphenylbenzoate.
Molecular Properties
| Compound Name | phosphanyl 2,3,4,5-tetraphenylbenzoate |
| PubChem CID | 141485205 |
| Molecular Formula | C31H23O2P |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | phosphanyl 2,3,4,5-tetraphenylbenzoate |
| SMILES | O=C(OP)c1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C31H23O2P/c32-31(33-34)27-21-26(22-13-5-1-6-14-22)28(23-15-7-2-8-16-23)30(25-19-11-4-12-20-25)29(27)24-17-9-3-10-18-24/h1-21H,34H2 |
| InChIKey | JDGUFCNHQRRNII-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphanyl 2,3,4,5-tetraphenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphanyl 2,3,4,5-tetraphenylbenzoate?
The IUPAC name of phosphanyl 2,3,4,5-tetraphenylbenzoate (CID 141485205) is phosphanyl 2,3,4,5-tetraphenylbenzoate.
What is the SMILES notation for phosphanyl 2,3,4,5-tetraphenylbenzoate?
The canonical SMILES for phosphanyl 2,3,4,5-tetraphenylbenzoate is O=C(OP)c1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of phosphanyl 2,3,4,5-tetraphenylbenzoate?
The InChIKey is JDGUFCNHQRRNII-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H23O2P/c32-31(33-34)27-21-26(22-13-5-1-6-14-22)28(23-15-7-2-8-16-23)30(25-19-11-4-12-20-25)29(27)24-17-9-3-10-18-24/h1-21H,34H2.
What are the key properties of phosphanyl 2,3,4,5-tetraphenylbenzoate?
phosphanyl 2,3,4,5-tetraphenylbenzoate has a molecular weight of 458.50 g/mol, XLogP of 8.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phosphanyl 2,3,4,5-tetraphenylbenzoate is sourced from PubChem (CID 141485205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).