C31H23O2P — CID 141485205
phosphanyl 2,3,4,5-tetraphenylbenzoate (PubChem CID 141485205) has the molecular formula C31H23O2P and a molecular weight of 458.50 g/mol. Its IUPAC name is phosphanyl 2,3,4,5-tetraphenylbenzoate.
| Compound Name | phosphanyl 2,3,4,5-tetraphenylbenzoate |
|---|---|
| PubChem CID | 141485205 |
| Molecular Formula | C31H23O2P |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | phosphanyl 2,3,4,5-tetraphenylbenzoate |
| SMILES | O=C(OP)c1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C31H23O2P/c32-31(33-34)27-21-26(22-13-5-1-6-14-22)28(23-15-7-2-8-16-23)30(25-19-11-4-12-20-25)29(27)24-17-9-3-10-18-24/h1-21H,34H2 |
| InChIKey | JDGUFCNHQRRNII-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|