C20H12Na2O4 — CID 134868371
disodium;4,5-diphenylphthalate (PubChem CID 134868371) has the molecular formula C20H12Na2O4 and a molecular weight of 362.29 g/mol. Its IUPAC name is disodium;4,5-diphenylphthalate.
| Compound Name | disodium;4,5-diphenylphthalate |
|---|---|
| PubChem CID | 134868371 |
| Molecular Formula | C20H12Na2O4 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | disodium;4,5-diphenylphthalate |
| SMILES | O=C([O-])c1cc(-c2ccccc2)c(-c2ccccc2)cc1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C20H14O4.2Na/c21-19(22)17-11-15(13-7-3-1-4-8-13)16(12-18(17)20(23)24)14-9-5-2-6-10-14;;/h1-12H,(H,21,22)(H,23,24);;/q;2*+1/p-2 |
| InChIKey | VNNWFOANVOKUGK-UHFFFAOYSA-L |
| XLogP | -4.24 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |