About dilithium;3-phenylphthalate
dilithium;3-phenylphthalate (PubChem CID 130387255) has the molecular formula C14H8Li2O4
and a molecular weight of 254.10 g/mol. Its IUPAC name is dilithium;3-phenylphthalate.
Molecular Properties
| Compound Name | dilithium;3-phenylphthalate |
| PubChem CID | 130387255 |
| Molecular Formula | C14H8Li2O4 |
| Molecular Weight | 254.10 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | dilithium;3-phenylphthalate |
| SMILES | O=C([O-])c1cccc(-c2ccccc2)c1C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C14H10O4.2Li/c15-13(16)11-8-4-7-10(12(11)14(17)18)9-5-2-1-3-6-9;;/h1-8H,(H,15,16)(H,17,18);;/q;2*+1/p-2 |
| InChIKey | AXIVXJVPJFMKNR-UHFFFAOYSA-L |
| XLogP | -5.91 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.10 |
| LogP ≤ 5 | -5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dilithium;3-phenylphthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;3-phenylphthalate?
The IUPAC name of dilithium;3-phenylphthalate (CID 130387255) is dilithium;3-phenylphthalate.
What is the SMILES notation for dilithium;3-phenylphthalate?
The canonical SMILES for dilithium;3-phenylphthalate is O=C([O-])c1cccc(-c2ccccc2)c1C(=O)[O-].[Li+].[Li+].
What is the InChIKey of dilithium;3-phenylphthalate?
The InChIKey is AXIVXJVPJFMKNR-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H10O4.2Li/c15-13(16)11-8-4-7-10(12(11)14(17)18)9-5-2-1-3-6-9;;/h1-8H,(H,15,16)(H,17,18);;/q;2*+1/p-2.
What are the key properties of dilithium;3-phenylphthalate?
dilithium;3-phenylphthalate has a molecular weight of 254.10 g/mol, XLogP of -5.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;3-phenylphthalate is sourced from PubChem (CID 130387255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).