About barium(2+);3-phenylphthalate
barium(2+);3-phenylphthalate (PubChem CID 141391844) has the molecular formula C14H8BaO4
and a molecular weight of 377.54 g/mol. Its IUPAC name is barium(2+);3-phenylphthalate.
Molecular Properties
| Compound Name | barium(2+);3-phenylphthalate |
| PubChem CID | 141391844 |
| Molecular Formula | C14H8BaO4 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | barium(2+);3-phenylphthalate |
| SMILES | O=C([O-])c1cccc(-c2ccccc2)c1C(=O)[O-].[Ba+2] |
| InChI | InChI=1S/C14H10O4.Ba/c15-13(16)11-8-4-7-10(12(11)14(17)18)9-5-2-1-3-6-9;/h1-8H,(H,15,16)(H,17,18);/q;+2/p-2 |
| InChIKey | YLOYONSHWZIKBF-UHFFFAOYSA-L |
| XLogP | -0.30 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze barium(2+);3-phenylphthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);3-phenylphthalate?
The IUPAC name of barium(2+);3-phenylphthalate (CID 141391844) is barium(2+);3-phenylphthalate.
What is the SMILES notation for barium(2+);3-phenylphthalate?
The canonical SMILES for barium(2+);3-phenylphthalate is O=C([O-])c1cccc(-c2ccccc2)c1C(=O)[O-].[Ba+2].
What is the InChIKey of barium(2+);3-phenylphthalate?
The InChIKey is YLOYONSHWZIKBF-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H10O4.Ba/c15-13(16)11-8-4-7-10(12(11)14(17)18)9-5-2-1-3-6-9;/h1-8H,(H,15,16)(H,17,18);/q;+2/p-2.
What are the key properties of barium(2+);3-phenylphthalate?
barium(2+);3-phenylphthalate has a molecular weight of 377.54 g/mol, XLogP of -0.30, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);3-phenylphthalate is sourced from PubChem (CID 141391844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).