C9H5NaO6 — CID 166682302
sodium 2,3-dicarboxybenzoate (PubChem CID 166682302) has the molecular formula C9H5NaO6 and a molecular weight of 232.12 g/mol. Its IUPAC name is sodium 2,3-dicarboxybenzoate.
| Compound Name | sodium 2,3-dicarboxybenzoate |
|---|---|
| PubChem CID | 166682302 |
| Molecular Formula | C9H5NaO6 |
| Molecular Weight | 232.12 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | sodium 2,3-dicarboxybenzoate |
| SMILES | O=C([O-])c1cccc(C(=O)O)c1C(=O)O.[Na+] |
| InChI | InChI=1S/C9H6O6.Na/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15;/h1-3H,(H,10,11)(H,12,13)(H,14,15);/q;+1/p-1 |
| InChIKey | OYDAMLHGFLCHMN-UHFFFAOYSA-M |
| XLogP | -3.55 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.12 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |