C24H19PRu — CID 161293596
ruthenium;(2,3,4-triphenylphenyl)phosphane (PubChem CID 161293596) has the molecular formula C24H19PRu and a molecular weight of 439.46 g/mol. Its IUPAC name is ruthenium;(2,3,4-triphenylphenyl)phosphane.
| Compound Name | ruthenium;(2,3,4-triphenylphenyl)phosphane |
|---|---|
| PubChem CID | 161293596 |
| Molecular Formula | C24H19PRu |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | ruthenium;(2,3,4-triphenylphenyl)phosphane |
| SMILES | Pc1ccc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.[Ru] |
| InChI | InChI=1S/C24H19P.Ru/c25-22-17-16-21(18-10-4-1-5-11-18)23(19-12-6-2-7-13-19)24(22)20-14-8-3-9-15-20;/h1-17H,25H2; |
| InChIKey | VGRKFYGVDJWZMX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|