C18H14S2 — CID 22227433
3,4-diphenylbenzene-1,2-dithiol (PubChem CID 22227433) has the molecular formula C18H14S2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3,4-diphenylbenzene-1,2-dithiol.
| Compound Name | 3,4-diphenylbenzene-1,2-dithiol |
|---|---|
| PubChem CID | 22227433 |
| Molecular Formula | C18H14S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 3,4-diphenylbenzene-1,2-dithiol |
| SMILES | Sc1ccc(-c2ccccc2)c(-c2ccccc2)c1S |
| InChI | InChI=1S/C18H14S2/c19-16-12-11-15(13-7-3-1-4-8-13)17(18(16)20)14-9-5-2-6-10-14/h1-12,19-20H |
| InChIKey | OIMZVYAKBPVWRZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|