C25H17Cl3 — CID 57019840
1,2,3-triphenyl-4-(trichloromethyl)benzene (PubChem CID 57019840) has the molecular formula C25H17Cl3 and a molecular weight of 423.77 g/mol. Its IUPAC name is 1,2,3-triphenyl-4-(trichloromethyl)benzene.
| Compound Name | 1,2,3-triphenyl-4-(trichloromethyl)benzene |
|---|---|
| PubChem CID | 57019840 |
| Molecular Formula | C25H17Cl3 |
| Molecular Weight | 423.77 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 1,2,3-triphenyl-4-(trichloromethyl)benzene |
| SMILES | ClC(Cl)(Cl)c1ccc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H17Cl3/c26-25(27,28)22-17-16-21(18-10-4-1-5-11-18)23(19-12-6-2-7-13-19)24(22)20-14-8-3-9-15-20/h1-17H |
| InChIKey | BHGJNEOKJBXVAQ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.77 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|