C24H20BrOP — CID 159320906
hydroxy-(2,3,4-triphenylphenyl)phosphanium bromide (PubChem CID 159320906) has the molecular formula C24H20BrOP and a molecular weight of 435.30 g/mol. Its IUPAC name is hydroxy-(2,3,4-triphenylphenyl)phosphanium bromide.
| Compound Name | hydroxy-(2,3,4-triphenylphenyl)phosphanium bromide |
|---|---|
| PubChem CID | 159320906 |
| Molecular Formula | C24H20BrOP |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | hydroxy-(2,3,4-triphenylphenyl)phosphanium bromide |
| SMILES | O[PH2+]c1ccc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.[Br-] |
| InChI | InChI=1S/C24H19OP.BrH/c25-26-22-17-16-21(18-10-4-1-5-11-18)23(19-12-6-2-7-13-19)24(22)20-14-8-3-9-15-20;/h1-17,25-26H;1H |
| InChIKey | LDTDXBPBUUPBOU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|