bromo-(2,3,4-triphenylphenyl)phosphinous acid

C24H18BrOP — CID 142735464

IUPACbromo-(2,3,4-triphenylphenyl)phosphinous acid
SMILESOP(Br)c1ccc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1
InChIInChI=1S/C24H18BrOP/c25-27(26)22-17-16-21(18-10-4-1-5-11-18)23(19-12-6-2-7-13-19)24(22)20-14-8-3-9-15-20/h1-17,26H
InChIKeyMSZCOVQOHKGSDK-UHFFFAOYSA-N
MW433.29 g/mol
LogP7.01
Rot. Bonds4

About bromo-(2,3,4-triphenylphenyl)phosphinous acid

bromo-(2,3,4-triphenylphenyl)phosphinous acid (PubChem CID 142735464) has the molecular formula C24H18BrOP and a molecular weight of 433.29 g/mol. Its IUPAC name is bromo-(2,3,4-triphenylphenyl)phosphinous acid.

Molecular Properties

Compound Namebromo-(2,3,4-triphenylphenyl)phosphinous acid
PubChem CID142735464
Molecular FormulaC24H18BrOP
Molecular Weight433.29 g/mol
Exact Mass432.03
IUPAC Namebromo-(2,3,4-triphenylphenyl)phosphinous acid
SMILESOP(Br)c1ccc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1
InChIInChI=1S/C24H18BrOP/c25-27(26)22-17-16-21(18-10-4-1-5-11-18)23(19-12-6-2-7-13-19)24(22)20-14-8-3-9-15-20/h1-17,26H
InChIKeyMSZCOVQOHKGSDK-UHFFFAOYSA-N
XLogP7.01
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500433.29
LogP ≤ 57.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze bromo-(2,3,4-triphenylphenyl)phosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bromo-(2,3,4-triphenylphenyl)phosphinous acid?
The IUPAC name of bromo-(2,3,4-triphenylphenyl)phosphinous acid (CID 142735464) is bromo-(2,3,4-triphenylphenyl)phosphinous acid.
What is the SMILES notation for bromo-(2,3,4-triphenylphenyl)phosphinous acid?
The canonical SMILES for bromo-(2,3,4-triphenylphenyl)phosphinous acid is OP(Br)c1ccc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of bromo-(2,3,4-triphenylphenyl)phosphinous acid?
The InChIKey is MSZCOVQOHKGSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18BrOP/c25-27(26)22-17-16-21(18-10-4-1-5-11-18)23(19-12-6-2-7-13-19)24(22)20-14-8-3-9-15-20/h1-17,26H.
What are the key properties of bromo-(2,3,4-triphenylphenyl)phosphinous acid?
bromo-(2,3,4-triphenylphenyl)phosphinous acid has a molecular weight of 433.29 g/mol, XLogP of 7.01, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromo-(2,3,4-triphenylphenyl)phosphinous acid is sourced from PubChem (CID 142735464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).