C24H18BrOP — CID 142735464
bromo-(2,3,4-triphenylphenyl)phosphinous acid (PubChem CID 142735464) has the molecular formula C24H18BrOP and a molecular weight of 433.29 g/mol. Its IUPAC name is bromo-(2,3,4-triphenylphenyl)phosphinous acid.
| Compound Name | bromo-(2,3,4-triphenylphenyl)phosphinous acid |
|---|---|
| PubChem CID | 142735464 |
| Molecular Formula | C24H18BrOP |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | bromo-(2,3,4-triphenylphenyl)phosphinous acid |
| SMILES | OP(Br)c1ccc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H18BrOP/c25-27(26)22-17-16-21(18-10-4-1-5-11-18)23(19-12-6-2-7-13-19)24(22)20-14-8-3-9-15-20/h1-17,26H |
| InChIKey | MSZCOVQOHKGSDK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|