C36H30BO3P — CID 159748341
boric acid;diphenyl-(2,3,4-triphenylphenyl)phosphane (PubChem CID 159748341) has the molecular formula C36H30BO3P and a molecular weight of 552.42 g/mol. Its IUPAC name is boric acid;diphenyl-(2,3,4-triphenylphenyl)phosphane.
| Compound Name | boric acid;diphenyl-(2,3,4-triphenylphenyl)phosphane |
|---|---|
| PubChem CID | 159748341 |
| Molecular Formula | C36H30BO3P |
| Molecular Weight | 552.42 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | boric acid;diphenyl-(2,3,4-triphenylphenyl)phosphane |
| SMILES | OB(O)O.c1ccc(-c2ccc(P(c3ccccc3)c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H27P.BH3O3/c1-6-16-28(17-7-1)33-26-27-34(37(31-22-12-4-13-23-31)32-24-14-5-15-25-32)36(30-20-10-3-11-21-30)35(33)29-18-8-2-9-19-29;2-1(3)4/h1-27H;2-4H |
| InChIKey | NDIIVIGAIGSBON-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.42 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|