About boric acid;triphenylphosphane
boric acid;triphenylphosphane (PubChem CID 173323232) has the molecular formula C18H48B11O33P
and a molecular weight of 942.46 g/mol. Its IUPAC name is boric acid;triphenylphosphane.
Molecular Properties
| Compound Name | boric acid;triphenylphosphane |
| PubChem CID | 173323232 |
| Molecular Formula | C18H48B11O33P |
| Molecular Weight | 942.46 g/mol |
| Exact Mass | 944.28 |
| IUPAC Name | boric acid;triphenylphosphane |
| SMILES | OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.11BH3O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;11*2-1(3)4/h1-15H;11*2-4H |
| InChIKey | DJAWQLGMOMLSHI-UHFFFAOYSA-N |
| XLogP | -19.12 |
| TPSA | 667.59 Ų |
| H-Bond Donors | 33 |
| H-Bond Acceptors | 33 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 942.46 |
| LogP ≤ 5 | -19.12 |
| H-Bond Donors ≤ 5 | 33 |
| H-Bond Acceptors ≤ 10 | 33 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze boric acid;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;triphenylphosphane?
The IUPAC name of boric acid;triphenylphosphane (CID 173323232) is boric acid;triphenylphosphane.
What is the SMILES notation for boric acid;triphenylphosphane?
The canonical SMILES for boric acid;triphenylphosphane is OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of boric acid;triphenylphosphane?
The InChIKey is DJAWQLGMOMLSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.11BH3O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;11*2-1(3)4/h1-15H;11*2-4H.
What are the key properties of boric acid;triphenylphosphane?
boric acid;triphenylphosphane has a molecular weight of 942.46 g/mol, XLogP of -19.12, 3 rotatable bonds, 33 hydrogen bond donors, and 33 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;triphenylphosphane is sourced from PubChem (CID 173323232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).