C25H24BNO3 — CID 67925015
azane;(2,3,4-triphenylphenyl)methoxyboronic acid (PubChem CID 67925015) has the molecular formula C25H24BNO3 and a molecular weight of 397.28 g/mol. Its IUPAC name is azane;(2,3,4-triphenylphenyl)methoxyboronic acid.
| Compound Name | azane;(2,3,4-triphenylphenyl)methoxyboronic acid |
|---|---|
| PubChem CID | 67925015 |
| Molecular Formula | C25H24BNO3 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | azane;(2,3,4-triphenylphenyl)methoxyboronic acid |
| SMILES | N.OB(O)OCc1ccc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H21BO3.H3N/c27-26(28)29-18-22-16-17-23(19-10-4-1-5-11-19)25(21-14-8-3-9-15-21)24(22)20-12-6-2-7-13-20;/h1-17,27-28H,18H2;1H3 |
| InChIKey | MXKFWRMRALIDIH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 84.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|