C14H18BNO3 — CID 174484703
2-aminoethoxyboronic acid;1,1'-biphenyl (PubChem CID 174484703) has the molecular formula C14H18BNO3 and a molecular weight of 259.11 g/mol. Its IUPAC name is 2-aminoethoxyboronic acid;1,1'-biphenyl.
| Compound Name | 2-aminoethoxyboronic acid;1,1'-biphenyl |
|---|---|
| PubChem CID | 174484703 |
| Molecular Formula | C14H18BNO3 |
| Molecular Weight | 259.11 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-aminoethoxyboronic acid;1,1'-biphenyl |
| SMILES | NCCOB(O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H8BNO3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;4-1-2-7-3(5)6/h1-10H;5-6H,1-2,4H2 |
| InChIKey | MXXQVGJKOFZRSG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.11 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|