C22H24BLiO3 — CID 173103949
lithium;hydride;4,4,4-triphenylbutoxyboronic acid (PubChem CID 173103949) has the molecular formula C22H24BLiO3 and a molecular weight of 354.18 g/mol. Its IUPAC name is lithium;hydride;4,4,4-triphenylbutoxyboronic acid.
| Compound Name | lithium;hydride;4,4,4-triphenylbutoxyboronic acid |
|---|---|
| PubChem CID | 173103949 |
| Molecular Formula | C22H24BLiO3 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | lithium;hydride;4,4,4-triphenylbutoxyboronic acid |
| SMILES | OB(O)OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C22H23BO3.Li.H/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;;/h1-9,11-16,24-25H,10,17-18H2;;/q;+1;-1 |
| InChIKey | KRNKTAQJKYQYKB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|