C32H35BO4S — CID 67649725
[dimethyl(phenacyl)-λ4-sulfanyl]oxy-(4,4,4-triphenylbutoxy)borinic acid (PubChem CID 67649725) has the molecular formula C32H35BO4S and a molecular weight of 526.51 g/mol. Its IUPAC name is [dimethyl(phenacyl)-λ4-sulfanyl]oxy-(4,4,4-triphenylbutoxy)borinic acid.
| Compound Name | [dimethyl(phenacyl)-λ4-sulfanyl]oxy-(4,4,4-triphenylbutoxy)borinic acid |
|---|---|
| PubChem CID | 67649725 |
| Molecular Formula | C32H35BO4S |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | [dimethyl(phenacyl)-λ4-sulfanyl]oxy-(4,4,4-triphenylbutoxy)borinic acid |
| SMILES | CS(C)(CC(=O)c1ccccc1)OB(O)OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H35BO4S/c1-38(2,26-31(34)27-16-7-3-8-17-27)37-33(35)36-25-15-24-32(28-18-9-4-10-19-28,29-20-11-5-12-21-29)30-22-13-6-14-23-30/h3-14,16-23,35H,15,24-26H2,1-2H3 |
| InChIKey | YVYVBEBXGRJFAA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|