C24H26BFO3 — CID 174057043
[6-(4-fluorophenyl)-6,6-diphenylhexoxy]boronic acid (PubChem CID 174057043) has the molecular formula C24H26BFO3 and a molecular weight of 392.28 g/mol. Its IUPAC name is [6-(4-fluorophenyl)-6,6-diphenylhexoxy]boronic acid.
| Compound Name | [6-(4-fluorophenyl)-6,6-diphenylhexoxy]boronic acid |
|---|---|
| PubChem CID | 174057043 |
| Molecular Formula | C24H26BFO3 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [6-(4-fluorophenyl)-6,6-diphenylhexoxy]boronic acid |
| SMILES | OB(O)OCCCCCC(c1ccccc1)(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H26BFO3/c26-23-16-14-22(15-17-23)24(20-10-4-1-5-11-20,21-12-6-2-7-13-21)18-8-3-9-19-29-25(27)28/h1-2,4-7,10-17,27-28H,3,8-9,18-19H2 |
| InChIKey | XPTWQTVNIGPUDF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|