About 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane
4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane (PubChem CID 173182288) has the molecular formula C22H19F3Sn
and a molecular weight of 459.10 g/mol. Its IUPAC name is 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane.
Molecular Properties
| Compound Name | 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane |
| PubChem CID | 173182288 |
| Molecular Formula | C22H19F3Sn |
| Molecular Weight | 459.10 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane |
| SMILES | Fc1ccc(C(CCC[SnH])(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H18F3.Sn.H/c1-2-15-22(16-3-9-19(23)10-4-16,17-5-11-20(24)12-6-17)18-7-13-21(25)14-8-18;;/h3-14H,1-2,15H2;; |
| InChIKey | CIOACRINCLWRAC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.10 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane?
The IUPAC name of 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane (CID 173182288) is 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane.
What is the SMILES notation for 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane?
The canonical SMILES for 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane is Fc1ccc(C(CCC[SnH])(c2ccc(F)cc2)c2ccc(F)cc2)cc1.
What is the InChIKey of 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane?
The InChIKey is CIOACRINCLWRAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F3.Sn.H/c1-2-15-22(16-3-9-19(23)10-4-16,17-5-11-20(24)12-6-17)18-7-13-21(25)14-8-18;;/h3-14H,1-2,15H2;;.
What are the key properties of 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane?
4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane has a molecular weight of 459.10 g/mol, XLogP of 5.54, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane is sourced from PubChem (CID 173182288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).