C22H19F3Sn — CID 173182288
4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane (PubChem CID 173182288) has the molecular formula C22H19F3Sn and a molecular weight of 459.10 g/mol. Its IUPAC name is 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane.
| Compound Name | 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane |
|---|---|
| PubChem CID | 173182288 |
| Molecular Formula | C22H19F3Sn |
| Molecular Weight | 459.10 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 4,4,4-tris(4-fluorophenyl)butyl-λ2-stannane |
| SMILES | Fc1ccc(C(CCC[SnH])(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H18F3.Sn.H/c1-2-15-22(16-3-9-19(23)10-4-16,17-5-11-20(24)12-6-17)18-7-13-21(25)14-8-18;;/h3-14H,1-2,15H2;; |
| InChIKey | CIOACRINCLWRAC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.10 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|