C19H24F2N2 — CID 20502290
4,4-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine (PubChem CID 20502290) has the molecular formula C19H24F2N2 and a molecular weight of 318.41 g/mol. Its IUPAC name is 4,4-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine.
| Compound Name | 4,4-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine |
|---|---|
| PubChem CID | 20502290 |
| Molecular Formula | C19H24F2N2 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 4,4-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine |
| SMILES | CC(C)(N)C(CCCN)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H24F2N2/c1-18(2,23)19(12-3-13-22,14-4-8-16(20)9-5-14)15-6-10-17(21)11-7-15/h4-11H,3,12-13,22-23H2,1-2H3 |
| InChIKey | QVZFQGCHKTZVNH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |