C10H10F5N — CID 115042991
3,4,4,4-tetrafluoro-3-(4-fluorophenyl)butan-1-amine (PubChem CID 115042991) has the molecular formula C10H10F5N and a molecular weight of 239.19 g/mol. Its IUPAC name is 3,4,4,4-tetrafluoro-3-(4-fluorophenyl)butan-1-amine.
| Compound Name | 3,4,4,4-tetrafluoro-3-(4-fluorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 115042991 |
| Molecular Formula | C10H10F5N |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3,4,4,4-tetrafluoro-3-(4-fluorophenyl)butan-1-amine |
| SMILES | NCCC(F)(c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H10F5N/c11-8-3-1-7(2-4-8)9(12,5-6-16)10(13,14)15/h1-4H,5-6,16H2 |
| InChIKey | XANMITWAPBNYEY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |