C17H22N2 — CID 67265829
3-methyl-2,2-diphenylbutane-1,3-diamine (PubChem CID 67265829) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-methyl-2,2-diphenylbutane-1,3-diamine.
| Compound Name | 3-methyl-2,2-diphenylbutane-1,3-diamine |
|---|---|
| PubChem CID | 67265829 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 3-methyl-2,2-diphenylbutane-1,3-diamine |
| SMILES | CC(C)(N)C(CN)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2/c1-16(2,19)17(13-18,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,13,18-19H2,1-2H3 |
| InChIKey | SFBXZZHWKPCMLV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |