About phenylmethanamine;2-phenylpropan-2-amine;hydrochloride
phenylmethanamine;2-phenylpropan-2-amine;hydrochloride (PubChem CID 174901598) has the molecular formula C16H23ClN2
and a molecular weight of 278.83 g/mol. Its IUPAC name is phenylmethanamine;2-phenylpropan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | phenylmethanamine;2-phenylpropan-2-amine;hydrochloride |
| PubChem CID | 174901598 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | phenylmethanamine;2-phenylpropan-2-amine;hydrochloride |
| SMILES | CC(C)(N)c1ccccc1.Cl.NCc1ccccc1 |
| InChI | InChI=1S/C9H13N.C7H9N.ClH/c1-9(2,10)8-6-4-3-5-7-8;8-6-7-4-2-1-3-5-7;/h3-7H,10H2,1-2H3;1-5H,6,8H2;1H |
| InChIKey | USENLTUDPWEQOK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenylmethanamine;2-phenylpropan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanamine;2-phenylpropan-2-amine;hydrochloride?
The IUPAC name of phenylmethanamine;2-phenylpropan-2-amine;hydrochloride (CID 174901598) is phenylmethanamine;2-phenylpropan-2-amine;hydrochloride.
What is the SMILES notation for phenylmethanamine;2-phenylpropan-2-amine;hydrochloride?
The canonical SMILES for phenylmethanamine;2-phenylpropan-2-amine;hydrochloride is CC(C)(N)c1ccccc1.Cl.NCc1ccccc1.
What is the InChIKey of phenylmethanamine;2-phenylpropan-2-amine;hydrochloride?
The InChIKey is USENLTUDPWEQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C7H9N.ClH/c1-9(2,10)8-6-4-3-5-7-8;8-6-7-4-2-1-3-5-7;/h3-7H,10H2,1-2H3;1-5H,6,8H2;1H.
What are the key properties of phenylmethanamine;2-phenylpropan-2-amine;hydrochloride?
phenylmethanamine;2-phenylpropan-2-amine;hydrochloride has a molecular weight of 278.83 g/mol, XLogP of 3.45, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanamine;2-phenylpropan-2-amine;hydrochloride is sourced from PubChem (CID 174901598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).