About 3-phenylpentan-3-amine;2-phenylpropan-2-amine
3-phenylpentan-3-amine;2-phenylpropan-2-amine (PubChem CID 67930723) has the molecular formula C20H30N2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 3-phenylpentan-3-amine;2-phenylpropan-2-amine.
Molecular Properties
| Compound Name | 3-phenylpentan-3-amine;2-phenylpropan-2-amine |
| PubChem CID | 67930723 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 3-phenylpentan-3-amine;2-phenylpropan-2-amine |
| SMILES | CC(C)(N)c1ccccc1.CCC(N)(CC)c1ccccc1 |
| InChI | InChI=1S/C11H17N.C9H13N/c1-3-11(12,4-2)10-8-6-5-7-9-10;1-9(2,10)8-6-4-3-5-7-8/h5-9H,3-4,12H2,1-2H3;3-7H,10H2,1-2H3 |
| InChIKey | WXTMXQOBTWHCCL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenylpentan-3-amine;2-phenylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpentan-3-amine;2-phenylpropan-2-amine?
The IUPAC name of 3-phenylpentan-3-amine;2-phenylpropan-2-amine (CID 67930723) is 3-phenylpentan-3-amine;2-phenylpropan-2-amine.
What is the SMILES notation for 3-phenylpentan-3-amine;2-phenylpropan-2-amine?
The canonical SMILES for 3-phenylpentan-3-amine;2-phenylpropan-2-amine is CC(C)(N)c1ccccc1.CCC(N)(CC)c1ccccc1.
What is the InChIKey of 3-phenylpentan-3-amine;2-phenylpropan-2-amine?
The InChIKey is WXTMXQOBTWHCCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.C9H13N/c1-3-11(12,4-2)10-8-6-5-7-9-10;1-9(2,10)8-6-4-3-5-7-8/h5-9H,3-4,12H2,1-2H3;3-7H,10H2,1-2H3.
What are the key properties of 3-phenylpentan-3-amine;2-phenylpropan-2-amine?
3-phenylpentan-3-amine;2-phenylpropan-2-amine has a molecular weight of 298.47 g/mol, XLogP of 4.54, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpentan-3-amine;2-phenylpropan-2-amine is sourced from PubChem (CID 67930723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).