C16H26 — CID 147184303
(3-ethyl-4,4-dimethylhexan-3-yl)benzene (PubChem CID 147184303) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (3-ethyl-4,4-dimethylhexan-3-yl)benzene.
| Compound Name | (3-ethyl-4,4-dimethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 147184303 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (3-ethyl-4,4-dimethylhexan-3-yl)benzene |
| SMILES | CCC(C)(C)C(CC)(CC)c1ccccc1 |
| InChI | InChI=1S/C16H26/c1-6-15(4,5)16(7-2,8-3)14-12-10-9-11-13-14/h9-13H,6-8H2,1-5H3 |
| InChIKey | CAEJGUUTLVWLHR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |