C14H22S — CID 163513171
4,4-dimethyl-3-phenylhexane-3-thiol (PubChem CID 163513171) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is 4,4-dimethyl-3-phenylhexane-3-thiol.
| Compound Name | 4,4-dimethyl-3-phenylhexane-3-thiol |
|---|---|
| PubChem CID | 163513171 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4,4-dimethyl-3-phenylhexane-3-thiol |
| SMILES | CCC(C)(C)C(S)(CC)c1ccccc1 |
| InChI | InChI=1S/C14H22S/c1-5-13(3,4)14(15,6-2)12-10-8-7-9-11-12/h7-11,15H,5-6H2,1-4H3 |
| InChIKey | DELBLPGFHVHLQQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|