C14H17ClN2 — CID 139989781
1,1-diphenylethane-1,2-diamine;hydrochloride (PubChem CID 139989781) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 1,1-diphenylethane-1,2-diamine;hydrochloride.
| Compound Name | 1,1-diphenylethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 139989781 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1,1-diphenylethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NCC(N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H16N2.ClH/c15-11-14(16,12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-10H,11,15-16H2;1H |
| InChIKey | NHOFWRWBLVOHLB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |