C17H23ClN2 — CID 54599759
N',N'-dimethyl-2,2-diphenylpropane-1,3-diamine;hydrochloride (PubChem CID 54599759) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is N',N'-dimethyl-2,2-diphenylpropane-1,3-diamine;hydrochloride.
| Compound Name | N',N'-dimethyl-2,2-diphenylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 54599759 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N',N'-dimethyl-2,2-diphenylpropane-1,3-diamine;hydrochloride |
| SMILES | CN(C)CC(CN)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C17H22N2.ClH/c1-19(2)14-17(13-18,15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12H,13-14,18H2,1-2H3;1H |
| InChIKey | VAONZKQNMMYMRY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |