C19H26N2O — CID 59200487
N'-(2-methoxyethyl)-N'-methyl-2,2-diphenylpropane-1,3-diamine (PubChem CID 59200487) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-methyl-2,2-diphenylpropane-1,3-diamine.
| Compound Name | N'-(2-methoxyethyl)-N'-methyl-2,2-diphenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 59200487 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N'-(2-methoxyethyl)-N'-methyl-2,2-diphenylpropane-1,3-diamine |
| SMILES | COCCN(C)CC(CN)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O/c1-21(13-14-22-2)16-19(15-20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12H,13-16,20H2,1-2H3 |
| InChIKey | ONVLFMICDNPILW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |