C15H11F2NO — CID 171986042
3,3-bis(4-fluorophenyl)-3-hydroxypropanenitrile (PubChem CID 171986042) has the molecular formula C15H11F2NO and a molecular weight of 259.26 g/mol. Its IUPAC name is 3,3-bis(4-fluorophenyl)-3-hydroxypropanenitrile.
| Compound Name | 3,3-bis(4-fluorophenyl)-3-hydroxypropanenitrile |
|---|---|
| PubChem CID | 171986042 |
| Molecular Formula | C15H11F2NO |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3,3-bis(4-fluorophenyl)-3-hydroxypropanenitrile |
| SMILES | N#CCC(O)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11F2NO/c16-13-5-1-11(2-6-13)15(19,9-10-18)12-3-7-14(17)8-4-12/h1-8,19H,9H2 |
| InChIKey | CSPUGEBYSDZNRH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |