C9H5F4N — CID 116840719
3-(3,4-difluorophenyl)-3,3-difluoropropanenitrile (PubChem CID 116840719) has the molecular formula C9H5F4N and a molecular weight of 203.14 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-3,3-difluoropropanenitrile.
| Compound Name | 3-(3,4-difluorophenyl)-3,3-difluoropropanenitrile |
|---|---|
| PubChem CID | 116840719 |
| Molecular Formula | C9H5F4N |
| Molecular Weight | 203.14 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 3-(3,4-difluorophenyl)-3,3-difluoropropanenitrile |
| SMILES | N#CCC(F)(F)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H5F4N/c10-7-2-1-6(5-8(7)11)9(12,13)3-4-14/h1-2,5H,3H2 |
| InChIKey | ACDMMCGLJPVNQM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.14 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |