C17H14F3NO — CID 19425851
3-hydroxy-3-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]propanenitrile (PubChem CID 19425851) has the molecular formula C17H14F3NO and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-hydroxy-3-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]propanenitrile.
| Compound Name | 3-hydroxy-3-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 19425851 |
| Molecular Formula | C17H14F3NO |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-hydroxy-3-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]propanenitrile |
| SMILES | Cc1ccc(C(O)(CC#N)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H14F3NO/c1-12-2-4-13(5-3-12)16(22,10-11-21)14-6-8-15(9-7-14)17(18,19)20/h2-9,22H,10H2,1H3 |
| InChIKey | GFVQPBHTJBZQNH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |