C30H15F6N3 — CID 174092533
2-[2,3-bis[cyano-[4-(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-2-(4-methylphenyl)acetonitrile (PubChem CID 174092533) has the molecular formula C30H15F6N3 and a molecular weight of 531.46 g/mol. Its IUPAC name is 2-[2,3-bis[cyano-[4-(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-2-(4-methylphenyl)acetonitrile.
| Compound Name | 2-[2,3-bis[cyano-[4-(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-2-(4-methylphenyl)acetonitrile |
|---|---|
| PubChem CID | 174092533 |
| Molecular Formula | C30H15F6N3 |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 2-[2,3-bis[cyano-[4-(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-2-(4-methylphenyl)acetonitrile |
| SMILES | Cc1ccc(C(C#N)=C2C(=C(C#N)c3ccc(C(F)(F)F)cc3)C2=C(C#N)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H15F6N3/c1-17-2-4-18(5-3-17)23(14-37)26-27(24(15-38)19-6-10-21(11-7-19)29(31,32)33)28(26)25(16-39)20-8-12-22(13-9-20)30(34,35)36/h2-13H,1H3 |
| InChIKey | PTIGZLPIDBNASG-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|