C32H21F3N2 — CID 58029040
(Z)-3-[4-[4-[(Z)-2-isocyano-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]phenyl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 58029040) has the molecular formula C32H21F3N2 and a molecular weight of 490.53 g/mol. Its IUPAC name is (Z)-3-[4-[4-[(Z)-2-isocyano-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]phenyl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[4-[(Z)-2-isocyano-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 58029040 |
| Molecular Formula | C32H21F3N2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (Z)-3-[4-[4-[(Z)-2-isocyano-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | [C-]#[N+]/C(=C\c1ccc(-c2ccc(/C=C(\C#N)c3ccc(C)cc3)cc2)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H21F3N2/c1-22-3-9-27(10-4-22)29(21-36)19-23-5-11-25(12-6-23)26-13-7-24(8-14-26)20-31(37-2)28-15-17-30(18-16-28)32(33,34)35/h3-20H,1H3/b29-19+,31-20- |
| InChIKey | OIADFUFLUTUNGZ-GJSRVGCASA-N |
| XLogP | 9.16 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|