C32H15F5N4 — CID 158223299
2-[6-(diisocyanomethylidene)-4,8-difluoro-7-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 158223299) has the molecular formula C32H15F5N4 and a molecular weight of 550.49 g/mol. Its IUPAC name is 2-[6-(diisocyanomethylidene)-4,8-difluoro-7-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[6-(diisocyanomethylidene)-4,8-difluoro-7-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 158223299 |
| Molecular Formula | C32H15F5N4 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 2-[6-(diisocyanomethylidene)-4,8-difluoro-7-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2c(F)c3c(c(F)c2=C1c1ccc(C)cc1)CC(=C(C#N)C#N)C=3c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H15F5N4/c1-16-4-6-17(7-5-16)26-24(31(40-2)41-3)13-23-28(26)29(33)22-12-21(19(14-38)15-39)25(27(22)30(23)34)18-8-10-20(11-9-18)32(35,36)37/h4-11H,12-13H2,1H3 |
| InChIKey | WWFHJVYMMXLIQG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|