C32H4F16N4S2 — CID 159508389
2-[6-(diisocyanomethylidene)-3,7-bis(2,3,4,5,6-pentafluorophenyl)-4,8-bis(trifluoromethylsulfanyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 159508389) has the molecular formula C32H4F16N4S2 and a molecular weight of 812.51 g/mol. Its IUPAC name is 2-[6-(diisocyanomethylidene)-3,7-bis(2,3,4,5,6-pentafluorophenyl)-4,8-bis(trifluoromethylsulfanyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[6-(diisocyanomethylidene)-3,7-bis(2,3,4,5,6-pentafluorophenyl)-4,8-bis(trifluoromethylsulfanyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 159508389 |
| Molecular Formula | C32H4F16N4S2 |
| Molecular Weight | 812.51 g/mol |
| Exact Mass | 811.96 |
| IUPAC Name | 2-[6-(diisocyanomethylidene)-3,7-bis(2,3,4,5,6-pentafluorophenyl)-4,8-bis(trifluoromethylsulfanyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2c(SC(F)(F)F)c3c(c(SC(F)(F)F)c2=C1c1c(F)c(F)c(F)c(F)c1F)CC(=C(C#N)C#N)C=3c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C32H4F16N4S2/c1-51-30(52-2)11-4-10-15(13(11)17-20(35)24(39)27(42)25(40)21(17)36)28(53-31(43,44)45)9-3-8(7(5-49)6-50)12(14(9)29(10)54-32(46,47)48)16-18(33)22(37)26(41)23(38)19(16)34/h3-4H2 |
| InChIKey | RHCYYJDDTRMJGF-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.51 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|