C32H7F13N4O — CID 161215612
2-[6-(diisocyanomethylidene)-7-methyl-4,8-bis(2,3,4,5,6-pentafluorophenyl)-3-(trifluoromethoxy)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 161215612) has the molecular formula C32H7F13N4O and a molecular weight of 710.41 g/mol. Its IUPAC name is 2-[6-(diisocyanomethylidene)-7-methyl-4,8-bis(2,3,4,5,6-pentafluorophenyl)-3-(trifluoromethoxy)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[6-(diisocyanomethylidene)-7-methyl-4,8-bis(2,3,4,5,6-pentafluorophenyl)-3-(trifluoromethoxy)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 161215612 |
| Molecular Formula | C32H7F13N4O |
| Molecular Weight | 710.41 g/mol |
| Exact Mass | 710.04 |
| IUPAC Name | 2-[6-(diisocyanomethylidene)-7-methyl-4,8-bis(2,3,4,5,6-pentafluorophenyl)-3-(trifluoromethoxy)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2c(-c3c(F)c(F)c(F)c(F)c3F)c3c(c(-c4c(F)c(F)c(F)c(F)c4F)c2=C1C)CC(=C(C#N)C#N)C=3OC(F)(F)F |
| InChI | InChI=1S/C32H7F13N4O/c1-8-10(31(48-2)49-3)4-12-14(8)15(18-20(33)24(37)28(41)25(38)21(18)34)13-5-11(9(6-46)7-47)30(50-32(43,44)45)17(13)16(12)19-22(35)26(39)29(42)27(40)23(19)36/h4-5H2,1H3 |
| InChIKey | HSJYJQKBKOFFKG-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 65.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.41 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|