C34H17F7N4O5S2 — CID 161390567
2-[4,8-bis(3,5-difluoro-4-methylsulfonylphenyl)-6-(diisocyanomethylidene)-7-methyl-3-(trifluoromethoxy)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 161390567) has the molecular formula C34H17F7N4O5S2 and a molecular weight of 758.65 g/mol. Its IUPAC name is 2-[4,8-bis(3,5-difluoro-4-methylsulfonylphenyl)-6-(diisocyanomethylidene)-7-methyl-3-(trifluoromethoxy)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[4,8-bis(3,5-difluoro-4-methylsulfonylphenyl)-6-(diisocyanomethylidene)-7-methyl-3-(trifluoromethoxy)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 161390567 |
| Molecular Formula | C34H17F7N4O5S2 |
| Molecular Weight | 758.65 g/mol |
| Exact Mass | 758.05 |
| IUPAC Name | 2-[4,8-bis(3,5-difluoro-4-methylsulfonylphenyl)-6-(diisocyanomethylidene)-7-methyl-3-(trifluoromethoxy)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2c(-c3cc(F)c(S(C)(=O)=O)c(F)c3)c3c(c(-c4cc(F)c(S(C)(=O)=O)c(F)c4)c2=C1C)CC(=C(C#N)C#N)C=3OC(F)(F)F |
| InChI | InChI=1S/C34H17F7N4O5S2/c1-14-18(33(44-2)45-3)10-20-26(14)27(15-6-22(35)31(23(36)7-15)51(4,46)47)21-11-19(17(12-42)13-43)30(50-34(39,40)41)29(21)28(20)16-8-24(37)32(25(38)9-16)52(5,48)49/h6-9H,10-11H2,1,4-5H3 |
| InChIKey | NFGOLVAQYNHBKU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 133.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|