C32H13F7N4 — CID 158397601
2-[4,8-bis(3,5-difluorophenyl)-6-(diisocyanomethylidene)-7-methyl-3-(trifluoromethyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 158397601) has the molecular formula C32H13F7N4 and a molecular weight of 586.47 g/mol. Its IUPAC name is 2-[4,8-bis(3,5-difluorophenyl)-6-(diisocyanomethylidene)-7-methyl-3-(trifluoromethyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[4,8-bis(3,5-difluorophenyl)-6-(diisocyanomethylidene)-7-methyl-3-(trifluoromethyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 158397601 |
| Molecular Formula | C32H13F7N4 |
| Molecular Weight | 586.47 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 2-[4,8-bis(3,5-difluorophenyl)-6-(diisocyanomethylidene)-7-methyl-3-(trifluoromethyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2c(-c3cc(F)cc(F)c3)c3c(c(-c4cc(F)cc(F)c4)c2=C1C)CC(=C(C#N)C#N)C=3C(F)(F)F |
| InChI | InChI=1S/C32H13F7N4/c1-14-22(31(42-2)43-3)10-24-26(14)27(15-4-18(33)8-19(34)5-15)25-11-23(17(12-40)13-41)30(32(37,38)39)29(25)28(24)16-6-20(35)9-21(36)7-16/h4-9H,10-11H2,1H3 |
| InChIKey | JZDOKSDBKOZQSY-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.47 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|