C32H8F12N4O4S2 — CID 159843050
2-[4,8-bis[3,5-difluoro-4-(trifluoromethylsulfonyl)phenyl]-6-(diisocyanomethylidene)-3,7-difluoro-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 159843050) has the molecular formula C32H8F12N4O4S2 and a molecular weight of 804.55 g/mol. Its IUPAC name is 2-[4,8-bis[3,5-difluoro-4-(trifluoromethylsulfonyl)phenyl]-6-(diisocyanomethylidene)-3,7-difluoro-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[4,8-bis[3,5-difluoro-4-(trifluoromethylsulfonyl)phenyl]-6-(diisocyanomethylidene)-3,7-difluoro-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 159843050 |
| Molecular Formula | C32H8F12N4O4S2 |
| Molecular Weight | 804.55 g/mol |
| Exact Mass | 803.98 |
| IUPAC Name | 2-[4,8-bis[3,5-difluoro-4-(trifluoromethylsulfonyl)phenyl]-6-(diisocyanomethylidene)-3,7-difluoro-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2c(-c3cc(F)c(S(=O)(=O)C(F)(F)F)c(F)c3)c3c(c(-c4cc(F)c(S(=O)(=O)C(F)(F)F)c(F)c4)c2=C1F)CC(=C(C#N)C#N)C=3F |
| InChI | InChI=1S/C32H8F12N4O4S2/c1-47-30(48-2)17-8-16-23(12-5-20(35)29(21(36)6-12)54(51,52)32(42,43)44)24-15(7-14(26(24)37)13(9-45)10-46)22(25(16)27(17)38)11-3-18(33)28(19(34)4-11)53(49,50)31(39,40)41/h3-6H,7-8H2 |
| InChIKey | WJJDPABZUJFKMJ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 124.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|