C32H10F10N4O4S2 — CID 158024639
2-[4,8-bis[3,5-difluoro-4-(trifluoromethylsulfonyl)phenyl]-6-(diisocyanomethylidene)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 158024639) has the molecular formula C32H10F10N4O4S2 and a molecular weight of 768.57 g/mol. Its IUPAC name is 2-[4,8-bis[3,5-difluoro-4-(trifluoromethylsulfonyl)phenyl]-6-(diisocyanomethylidene)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[4,8-bis[3,5-difluoro-4-(trifluoromethylsulfonyl)phenyl]-6-(diisocyanomethylidene)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 158024639 |
| Molecular Formula | C32H10F10N4O4S2 |
| Molecular Weight | 768.57 g/mol |
| Exact Mass | 768.00 |
| IUPAC Name | 2-[4,8-bis[3,5-difluoro-4-(trifluoromethylsulfonyl)phenyl]-6-(diisocyanomethylidene)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1C=c2c(c(-c3cc(F)c(S(=O)(=O)C(F)(F)F)c(F)c3)c3c(c2-c2cc(F)c(S(=O)(=O)C(F)(F)F)c(F)c2)CC(=C(C#N)C#N)C=3)C1 |
| InChI | InChI=1S/C32H10F10N4O4S2/c1-45-30(46-2)16-5-20-21(6-16)27(15-9-24(35)29(25(36)10-15)52(49,50)32(40,41)42)19-4-13(17(11-43)12-44)3-18(19)26(20)14-7-22(33)28(23(34)8-14)51(47,48)31(37,38)39/h3,6-10H,4-5H2 |
| InChIKey | AUUGGTWOJLKCMQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 124.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|