C32H8F6N6 — CID 159288639
2-[3-cyano-6-(diisocyanomethylidene)-7-isocyano-4,8-bis(3,4,5-trifluorophenyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 159288639) has the molecular formula C32H8F6N6 and a molecular weight of 590.45 g/mol. Its IUPAC name is 2-[3-cyano-6-(diisocyanomethylidene)-7-isocyano-4,8-bis(3,4,5-trifluorophenyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-6-(diisocyanomethylidene)-7-isocyano-4,8-bis(3,4,5-trifluorophenyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 159288639 |
| Molecular Formula | C32H8F6N6 |
| Molecular Weight | 590.45 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | 2-[3-cyano-6-(diisocyanomethylidene)-7-isocyano-4,8-bis(3,4,5-trifluorophenyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2c(-c3cc(F)c(F)c(F)c3)c3c(c(-c4cc(F)c(F)c(F)c4)c2=C1[N+]#[C-])CC(=C(C#N)C#N)C=3C#N |
| InChI | InChI=1S/C32H8F6N6/c1-42-31-19(32(43-2)44-3)9-18-25(13-4-21(33)29(37)22(34)5-13)27-17(8-16(20(27)12-41)15(10-39)11-40)26(28(18)31)14-6-23(35)30(38)24(36)7-14/h4-7H,8-9H2 |
| InChIKey | YMUZNNJXRWAEOG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|