C32H12F10N6S2 — CID 157462230
2-[3-cyano-6-(diisocyanomethylidene)-7-isocyano-4,8-bis[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 157462230) has the molecular formula C32H12F10N6S2 and a molecular weight of 734.60 g/mol. Its IUPAC name is 2-[3-cyano-6-(diisocyanomethylidene)-7-isocyano-4,8-bis[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-6-(diisocyanomethylidene)-7-isocyano-4,8-bis[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 157462230 |
| Molecular Formula | C32H12F10N6S2 |
| Molecular Weight | 734.60 g/mol |
| Exact Mass | 734.04 |
| IUPAC Name | 2-[3-cyano-6-(diisocyanomethylidene)-7-isocyano-4,8-bis[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2c(-c3ccc(S(F)(F)(F)(F)F)cc3)c3c(c(-c4ccc(S(F)(F)(F)(F)F)cc4)c2=C1[N+]#[C-])CC(=C(C#N)C#N)C=3C#N |
| InChI | InChI=1S/C32H12F10N6S2/c1-46-31-25(32(47-2)48-3)13-24-27(17-4-8-20(9-5-17)49(33,34,35,36)37)29-23(12-22(26(29)16-45)19(14-43)15-44)28(30(24)31)18-6-10-21(11-7-18)50(38,39,40,41)42/h4-11H,12-13H2 |
| InChIKey | QRRPJWYADIGZRU-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.60 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|