C28H6F8N6 — CID 159188460
2-[6-(diisocyanomethylidene)-3,7-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 159188460) has the molecular formula C28H6F8N6 and a molecular weight of 578.38 g/mol. Its IUPAC name is 2-[6-(diisocyanomethylidene)-3,7-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[6-(diisocyanomethylidene)-3,7-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 159188460 |
| Molecular Formula | C28H6F8N6 |
| Molecular Weight | 578.38 g/mol |
| Exact Mass | 578.05 |
| IUPAC Name | 2-[6-(diisocyanomethylidene)-3,7-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2cc3c(cc2=C1c1c(F)c(F)nc(F)c1F)CC(=C(C#N)C#N)C=3c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C28H6F8N6/c1-39-28(40-2)15-6-10-4-12-9(3-13(10)17(15)19-22(31)26(35)42-27(36)23(19)32)5-14(11(7-37)8-38)16(12)18-20(29)24(33)41-25(34)21(18)30/h3-4H,5-6H2 |
| InChIKey | ORFYHTKEIRYJPM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 82.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|