C32H17F3N4S — CID 159160476
2-[6-(diisocyanomethylidene)-7-(3-methylphenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 159160476) has the molecular formula C32H17F3N4S and a molecular weight of 546.58 g/mol. Its IUPAC name is 2-[6-(diisocyanomethylidene)-7-(3-methylphenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[6-(diisocyanomethylidene)-7-(3-methylphenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 159160476 |
| Molecular Formula | C32H17F3N4S |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 2-[6-(diisocyanomethylidene)-7-(3-methylphenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2cc3c(cc2=C1c1cccc(C)c1)CC(=C(C#N)C#N)C=3c1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C32H17F3N4S/c1-18-6-4-7-19(10-18)30-26-12-21-14-27(23(16-36)17-37)29(20-8-5-9-24(11-20)40-32(33,34)35)25(21)13-22(26)15-28(30)31(38-2)39-3/h4-13H,14-15H2,1H3 |
| InChIKey | RIGYSMIBQBHBJE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|