C26H2F10N4S2 — CID 171734521
2-[(5E)-5-[5-(diisocyanomethylidene)-3-(2,3,4,5,6-pentafluorophenyl)thiophen-2-ylidene]-4-(2,3,4,5,6-pentafluorophenyl)thiophen-2-ylidene]propanedinitrile (PubChem CID 171734521) has the molecular formula C26H2F10N4S2 and a molecular weight of 624.44 g/mol. Its IUPAC name is 2-[(5E)-5-[5-(diisocyanomethylidene)-3-(2,3,4,5,6-pentafluorophenyl)thiophen-2-ylidene]-4-(2,3,4,5,6-pentafluorophenyl)thiophen-2-ylidene]propanedinitrile.
| Compound Name | 2-[(5E)-5-[5-(diisocyanomethylidene)-3-(2,3,4,5,6-pentafluorophenyl)thiophen-2-ylidene]-4-(2,3,4,5,6-pentafluorophenyl)thiophen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 171734521 |
| Molecular Formula | C26H2F10N4S2 |
| Molecular Weight | 624.44 g/mol |
| Exact Mass | 623.96 |
| IUPAC Name | 2-[(5E)-5-[5-(diisocyanomethylidene)-3-(2,3,4,5,6-pentafluorophenyl)thiophen-2-ylidene]-4-(2,3,4,5,6-pentafluorophenyl)thiophen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=c1cc(-c2c(F)c(F)c(F)c(F)c2F)/c(=c2\sc(=C(C#N)C#N)cc2-c2c(F)c(F)c(F)c(F)c2F)s1 |
| InChI | InChI=1S/C26H2F10N4S2/c1-39-26(40-2)11-4-9(13-16(29)20(33)23(36)21(34)17(13)30)25(42-11)24-8(3-10(41-24)7(5-37)6-38)12-14(27)18(31)22(35)19(32)15(12)28/h3-4H/b25-24+ |
| InChIKey | BHQBTOWIVVCYRG-OCOZRVBESA-N |
| XLogP | 6.92 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.44 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|