C38H8F10N6 — CID 118121436
2-[2,5-bis[3-cyano-5-(2,3,4,5,6-pentafluorophenyl)phenyl]-4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]propanedinitrile (PubChem CID 118121436) has the molecular formula C38H8F10N6 and a molecular weight of 738.50 g/mol. Its IUPAC name is 2-[2,5-bis[3-cyano-5-(2,3,4,5,6-pentafluorophenyl)phenyl]-4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]propanedinitrile.
| Compound Name | 2-[2,5-bis[3-cyano-5-(2,3,4,5,6-pentafluorophenyl)phenyl]-4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 118121436 |
| Molecular Formula | C38H8F10N6 |
| Molecular Weight | 738.50 g/mol |
| Exact Mass | 738.07 |
| IUPAC Name | 2-[2,5-bis[3-cyano-5-(2,3,4,5,6-pentafluorophenyl)phenyl]-4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=c1cc(-c2cc(C#N)cc(-c3c(F)c(F)c(F)c(F)c3F)c2)c(=C(C#N)C#N)cc1-c1cc(C#N)cc(-c2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C38H8F10N6/c39-29-27(30(40)34(44)37(47)33(29)43)19-3-15(9-49)1-17(5-19)23-7-26(22(13-53)14-54)24(8-25(23)21(11-51)12-52)18-2-16(10-50)4-20(6-18)28-31(41)35(45)38(48)36(46)32(28)42/h1-8H |
| InChIKey | IGWVZWBIPBUGJW-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.50 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|