C36H10F4N6 — CID 138572466
2-[3,8-bis(4-cyano-2,6-difluorophenyl)-10-(dicyanomethylidene)indeno[2,3-a]inden-5-ylidene]propanedinitrile (PubChem CID 138572466) has the molecular formula C36H10F4N6 and a molecular weight of 602.51 g/mol. Its IUPAC name is 2-[3,8-bis(4-cyano-2,6-difluorophenyl)-10-(dicyanomethylidene)indeno[2,3-a]inden-5-ylidene]propanedinitrile.
| Compound Name | 2-[3,8-bis(4-cyano-2,6-difluorophenyl)-10-(dicyanomethylidene)indeno[2,3-a]inden-5-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 138572466 |
| Molecular Formula | C36H10F4N6 |
| Molecular Weight | 602.51 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | 2-[3,8-bis(4-cyano-2,6-difluorophenyl)-10-(dicyanomethylidene)indeno[2,3-a]inden-5-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C2=C(C(=C(C#N)C#N)c3ccc(-c4c(F)cc(C#N)cc4F)cc32)c2cc(-c3c(F)cc(C#N)cc3F)ccc21 |
| InChI | InChI=1S/C36H10F4N6/c37-27-5-17(11-41)6-28(38)33(27)19-1-3-23-25(9-19)35-32(22(15-45)16-46)24-4-2-20(34-29(39)7-18(12-42)8-30(34)40)10-26(24)36(35)31(23)21(13-43)14-44/h1-10H |
| InChIKey | GEXOHVSEHHNAJJ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.51 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|