C36H12F2N6 — CID 154603635
4-[(5Z,10E)-5,10-bis[cyano(isocyano)methylidene]-2-(3-fluoro-4-isocyanophenyl)indeno[2,1-a]inden-7-yl]-2-fluorobenzonitrile (PubChem CID 154603635) has the molecular formula C36H12F2N6 and a molecular weight of 566.53 g/mol. Its IUPAC name is 4-[(5Z,10E)-5,10-bis[cyano(isocyano)methylidene]-2-(3-fluoro-4-isocyanophenyl)indeno[2,1-a]inden-7-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[(5Z,10E)-5,10-bis[cyano(isocyano)methylidene]-2-(3-fluoro-4-isocyanophenyl)indeno[2,1-a]inden-7-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 154603635 |
| Molecular Formula | C36H12F2N6 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | 4-[(5Z,10E)-5,10-bis[cyano(isocyano)methylidene]-2-(3-fluoro-4-isocyanophenyl)indeno[2,1-a]inden-7-yl]-2-fluorobenzonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C2=C(/C(=C(\C#N)[N+]#[C-])c3cc(-c4ccc([N+]#[C-])c(F)c4)ccc32)c2ccc(-c3ccc(C#N)c(F)c3)cc21 |
| InChI | InChI=1S/C36H12F2N6/c1-42-30-11-8-22(15-29(30)38)20-7-10-25-27(13-20)34(32(18-41)44-3)35-24-9-6-19(21-4-5-23(16-39)28(37)14-21)12-26(24)33(36(25)35)31(17-40)43-2/h4-15H/b33-31-,34-32+ |
| InChIKey | XODULKRTHNRYGC-IUQQBYGBSA-N |
| XLogP | 8.97 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|