C34H8F2N8 — CID 140846426
(1Z)-2-[4-[(3E)-1-cyano-3-[cyano(isocyano)methylidene]-5-fluoro-6-isocyanoinden-2-yl]phenyl]-1-[cyano(isocyano)methylidene]-6-fluoro-3-isocyanoindene-5-carbonitrile (PubChem CID 140846426) has the molecular formula C34H8F2N8 and a molecular weight of 566.49 g/mol. Its IUPAC name is (1Z)-2-[4-[(3E)-1-cyano-3-[cyano(isocyano)methylidene]-5-fluoro-6-isocyanoinden-2-yl]phenyl]-1-[cyano(isocyano)methylidene]-6-fluoro-3-isocyanoindene-5-carbonitrile.
| Compound Name | (1Z)-2-[4-[(3E)-1-cyano-3-[cyano(isocyano)methylidene]-5-fluoro-6-isocyanoinden-2-yl]phenyl]-1-[cyano(isocyano)methylidene]-6-fluoro-3-isocyanoindene-5-carbonitrile |
|---|---|
| PubChem CID | 140846426 |
| Molecular Formula | C34H8F2N8 |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | (1Z)-2-[4-[(3E)-1-cyano-3-[cyano(isocyano)methylidene]-5-fluoro-6-isocyanoinden-2-yl]phenyl]-1-[cyano(isocyano)methylidene]-6-fluoro-3-isocyanoindene-5-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc(C3=C(C#N)c4cc([N+]#[C-])c(F)cc4/C3=C(/C#N)[N+]#[C-])cc2)/C(=C(/C#N)[N+]#[C-])c2cc(F)c(C#N)cc21 |
| InChI | InChI=1S/C34H8F2N8/c1-41-27-12-20-21(11-26(27)36)32(28(15-39)42-2)30(24(20)14-38)17-5-7-18(8-6-17)31-33(29(16-40)43-3)22-10-25(35)19(13-37)9-23(22)34(31)44-4/h5-12H/b32-28+,33-29- |
| InChIKey | VWORCSBSXKICDW-RYJJHBMFSA-N |
| XLogP | 7.94 |
| TPSA | 112.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|